EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:131411 - 12-methylpentadecanoic acid
| Formula | C16H32O2 |
| Net Charge | 0 |
| Average Mass | 256.430 |
| Monoisotopic Mass | 256.24023 |
| SMILES | CCCC(C)CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C16H32O2/c1-3-12-15(2)13-10-8-6-4-5-7-9-11-14-16(17)18/h15H,3-14H2,1-2H3,(H,17,18) |
| InChIKey | CUIYLSQWWZQCFB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coolia monotis (ncbitaxon:58156) | - | PubMed (11055386) | |
| Listeria monocytogenes (ncbitaxon:1639) | - | PubMed (26225744) | |
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (23475189) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-methylpentadecanoic acid (CHEBI:131411) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| 12-methylpentadecanoic acid (CHEBI:131411) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 12-methylpentadecanoic acid (CHEBI:131411) has role marine metabolite (CHEBI:76507) |
| 12-methylpentadecanoic acid (CHEBI:131411) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 12-methylpentadecanoic acid (CHEBI:131411) is a long-chain fatty acid (CHEBI:15904) |
| 12-methylpentadecanoic acid (CHEBI:131411) is a methyl-branched fatty acid (CHEBI:62499) |
| IUPAC Name |
|---|
| 12-methylpentadecanoic acid |
| Synonym | Source |
|---|---|
| C15:0-12-methyl | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1864793 | Reaxys |
| Citations |
|---|