EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H67NO7 |
| Net Charge | 0 |
| Average Mass | 613.921 |
| Monoisotopic Mass | 613.49175 |
| SMILES | C[C@H](CCCCCCCCCCCCCCCCCCCCCCC(=O)CC(=O)NCCO)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C35H67NO7/c1-29(42-35-33(40)28-32(39)30(2)43-35)23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24-31(38)27-34(41)36-25-26-37/h29-30,32-33,35,37,39-40H,3-28H2,1-2H3,(H,36,41)/t29-,30+,32-,33-,35-/m1/s1 |
| InChIKey | SAJBVZCNRGUWRN-MSYGGCQVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (23163760) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (26R)-26-[(α-L-ascarosyl)oxy]-N-(2-hydroxyethyl)-3-oxoheptacosanamide (CHEBI:131409) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| (26R)-26-[(α-L-ascarosyl)oxy]-N-(2-hydroxyethyl)-3-oxoheptacosanamide (CHEBI:131409) is a N-acylethanolamine (CHEBI:52640) |
| (26R)-26-[(α-L-ascarosyl)oxy]-N-(2-hydroxyethyl)-3-oxoheptacosanamide (CHEBI:131409) is a hydroxy fatty amide ascaroside (CHEBI:131400) |
| (26R)-26-[(α-L-ascarosyl)oxy]-N-(2-hydroxyethyl)-3-oxoheptacosanamide (CHEBI:131409) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| (26R)-26-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-N-(2-hydroxyethyl)-3-oxoheptacosanamide |
| Synonym | Source |
|---|---|
| (26R)-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-3-oxoheptacosanoic acid ethanolamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23412668 | Reaxys |
| Citations |
|---|