EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H62O6 |
| Net Charge | 0 |
| Average Mass | 542.842 |
| Monoisotopic Mass | 542.45464 |
| SMILES | CC(CCCCCCCCCCCCCCCCCCCCC[C@@H](C)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O)C(=O)O |
| InChI | InChI=1S/C32H62O6/c1-26(31(35)36)23-21-19-17-15-13-11-9-7-5-4-6-8-10-12-14-16-18-20-22-24-27(2)37-32-30(34)25-29(33)28(3)38-32/h26-30,32-34H,4-25H2,1-3H3,(H,35,36)/t26?,27-,28+,29-,30-,32-/m1/s1 |
| InChIKey | NHZOXAWESIICEW-VOQZVSCUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (23163760) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (24R)-24-[(α-L-ascarosyl)oxy]-2-methylpentacosanoic acid (CHEBI:131405) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| (24R)-24-[(α-L-ascarosyl)oxy]-2-methylpentacosanoic acid (CHEBI:131405) is a (ω−1)-hydroxy fatty acid ascaroside (CHEBI:79205) |
| (24R)-24-[(α-L-ascarosyl)oxy]-2-methylpentacosanoic acid (CHEBI:131405) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (24R)-24-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-2-methylpentacosanoic acid |
| Synonym | Source |
|---|---|
| (24R)-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2-methylpentacosanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23412671 | Reaxys |
| Citations |
|---|