EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H65NO6 |
| Net Charge | 0 |
| Average Mass | 583.895 |
| Monoisotopic Mass | 583.48119 |
| SMILES | C/C(=C\CCCCCCCCCCCCCCCCCCCC[C@@H](C)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O)C(=O)NCCO |
| InChI | InChI=1S/C34H65NO6/c1-28(33(39)35-25-26-36)23-21-19-17-15-13-11-9-7-5-4-6-8-10-12-14-16-18-20-22-24-29(2)40-34-32(38)27-31(37)30(3)41-34/h23,29-32,34,36-38H,4-22,24-27H2,1-3H3,(H,35,39)/b28-23+/t29-,30+,31-,32-,34-/m1/s1 |
| InChIKey | XONAGBHTCVDMMT-HGZOCMNVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caenorhabditis elegans (ncbitaxon:6239) | - | PubMed (23163760) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. semiochemical A molecular messenger released by an organism that affects the behaviour within or between species. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E,24R)-24-[(α-L-ascarosyl)oxy]-N-(2-hydroxyethyl)-2-methylpentacos-2-enamide (CHEBI:131396) has role Caenorhabditis elegans metabolite (CHEBI:78804) |
| (2E,24R)-24-[(α-L-ascarosyl)oxy]-N-(2-hydroxyethyl)-2-methylpentacos-2-enamide (CHEBI:131396) is a N-acylethanolamine (CHEBI:52640) |
| (2E,24R)-24-[(α-L-ascarosyl)oxy]-N-(2-hydroxyethyl)-2-methylpentacos-2-enamide (CHEBI:131396) is a enamide (CHEBI:51751) |
| (2E,24R)-24-[(α-L-ascarosyl)oxy]-N-(2-hydroxyethyl)-2-methylpentacos-2-enamide (CHEBI:131396) is a hydroxy fatty amide ascaroside (CHEBI:131400) |
| (2E,24R)-24-[(α-L-ascarosyl)oxy]-N-(2-hydroxyethyl)-2-methylpentacos-2-enamide (CHEBI:131396) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (2E,24R)-24-[(3,6-dideoxy-α-L-arabino-hexopyranosyl)oxy]-N-(2-hydroxyethyl)-2-methylpentacos-2-enamide |
| Synonym | Source |
|---|---|
| (24R)-(3'R,5'R-dihydroxy-6'S-methyl-(2H)-tetrahydropyran-2'-yloxy)-2-methyl-2E-pentacosenoic acid ethanolamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23412669 | Reaxys |
| Citations |
|---|