EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:131389 - magnesium citrate
| Formula | C6H6O7.Mg |
| Net Charge | 0 |
| Average Mass | 214.412 |
| Monoisotopic Mass | 213.99639 |
| SMILES | O=C([O-])CC(O)(CC(=O)[O-])C(=O)O.[Mg+2] |
| InChI | InChI=1S/C6H8O7.Mg/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;+2/p-2 |
| InChIKey | DIXGJWCZQHXZNR-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Biological Role: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Applications: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| magnesium citrate (CHEBI:131389) has part 3-carboxy-3-hydroxypentanedioate (CHEBI:35810) |
| magnesium citrate (CHEBI:131389) has role food acidity regulator (CHEBI:64049) |
| magnesium citrate (CHEBI:131389) has role laxative (CHEBI:50503) |
| magnesium citrate (CHEBI:131389) is a magnesium salt (CHEBI:33975) |
| IUPAC Name |
|---|
| magnesium 3-carboxy-3-hydroxypentanedioate |
| Synonyms | Source |
|---|---|
| E345 | ChEBI |
| Magnesium citrate dibasic | ChemIDplus |
| Magnesium hydrogen citrate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Magnesium_citrate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15570024 | Reaxys |
| CAS:144-23-0 | ChemIDplus |
| Citations |
|---|