EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:131389 - magnesium citrate
| Formula | C6H6O7.Mg |
| Net Charge | 0 |
| Average Mass | 214.412 |
| Monoisotopic Mass | 213.99639 |
| SMILES | O=C([O-])CC(O)(CC(=O)[O-])C(=O)O.[Mg+2] |
| InChI | InChI=1S/C6H8O7.Mg/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;+2/p-2 |
| InChIKey | DIXGJWCZQHXZNR-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Biological Role: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Applications: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| magnesium citrate (CHEBI:131389) has part 3-carboxy-3-hydroxypentanedioate (CHEBI:35810) |
| magnesium citrate (CHEBI:131389) has role food acidity regulator (CHEBI:64049) |
| magnesium citrate (CHEBI:131389) has role laxative (CHEBI:50503) |
| magnesium citrate (CHEBI:131389) is a magnesium salt (CHEBI:33975) |
| IUPAC Name |
|---|
| magnesium 3-carboxy-3-hydroxypentanedioate |
| Synonyms | Source |
|---|---|
| E345 | ChEBI |
| Magnesium citrate dibasic | ChemIDplus |
| Magnesium hydrogen citrate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Magnesium_citrate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15570024 | Reaxys |
| CAS:144-23-0 | ChemIDplus |
| Citations |
|---|