EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO4 |
| Net Charge | 0 |
| Average Mass | 195.174 |
| Monoisotopic Mass | 195.05316 |
| SMILES | O=C(O)/C(Cc1ccc(O)cc1)=N\O |
| InChI | InChI=1S/C9H9NO4/c11-7-3-1-6(2-4-7)5-8(10-14)9(12)13/h1-4,11,14H,5H2,(H,12,13)/b10-8- |
| InChIKey | HOSMGQOSNROJPE-NTMALXAHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (26839171) | ||
| - | MetaboLights (MTBLS298) | ||
| Aspergillus aculeatus (ncbitaxon:5053) | - | PubMed (19824618) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxyphenylpyruvic acid oxime (CHEBI:131385) has functional parent 4-hydroxyphenylpyruvic acid (CHEBI:15999) |
| 4-hydroxyphenylpyruvic acid oxime (CHEBI:131385) has role fungal metabolite (CHEBI:76946) |
| 4-hydroxyphenylpyruvic acid oxime (CHEBI:131385) has role marine metabolite (CHEBI:76507) |
| 4-hydroxyphenylpyruvic acid oxime (CHEBI:131385) is a ketoxime (CHEBI:24983) |
| 4-hydroxyphenylpyruvic acid oxime (CHEBI:131385) is a monocarboxylic acid (CHEBI:25384) |
| 4-hydroxyphenylpyruvic acid oxime (CHEBI:131385) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (2Z)-2-(hydroxyimino)-3-(4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 10470130 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2109554 | Reaxys |
| Citations |
|---|