EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | CC(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C5H10O5/c1-2(6)3(7)4(8)5(9)10/h2-4,6-8H,1H3,(H,9,10) |
| InChIKey | CHUMGDDVFASTDV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS298) | ||
| - | PubMed (26839171) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,4-trihydroxypentanoic acid (CHEBI:131364) has functional parent valeric acid (CHEBI:17418) |
| 2,3,4-trihydroxypentanoic acid (CHEBI:131364) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 2,3,4-trihydroxypentanoic acid (CHEBI:131364) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| 5-deoxypentonic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723060 | Reaxys |