EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O5 |
| Net Charge | 0 |
| Average Mass | 216.233 |
| Monoisotopic Mass | 216.09977 |
| SMILES | O=C(O)/C=C(\O)CCCCCCC(=O)O |
| InChI | InChI=1S/C10H16O5/c11-8(7-10(14)15)5-3-1-2-4-6-9(12)13/h7,11H,1-6H2,(H,12,13)(H,14,15)/b8-7- |
| InChIKey | ZFONAUHRORWDHV-FPLPWBNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (26839171) | ||
| - | MetaboLights (MTBLS298) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-3-hydroxydec-2-enedioic acid (CHEBI:131363) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| (Z)-3-hydroxydec-2-enedioic acid (CHEBI:131363) is a dicarboxylic acid (CHEBI:35692) |
| (Z)-3-hydroxydec-2-enedioic acid (CHEBI:131363) is a enol (CHEBI:33823) |
| Synonym | Source |
|---|---|
| (2Z)-3-hydroxydec-2-enedioic acid | ChEBI |