EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17N5O2S |
| Net Charge | 0 |
| Average Mass | 379.445 |
| Monoisotopic Mass | 379.11030 |
| SMILES | N#Cc1c(N)nc(SCC(N)=O)c(C#N)c1-c1ccc(OCC2CC2)cc1 |
| InChI | InChI=1S/C19H17N5O2S/c20-7-14-17(12-3-5-13(6-4-12)26-9-11-1-2-11)15(8-21)19(24-18(14)23)27-10-16(22)25/h3-6,11H,1-2,9-10H2,(H2,22,25)(H2,23,24) |
| InChIKey | ZTYHZMAZUWOXNC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | adenosine A2B receptor agonist An agonist at the A2B receptor. |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BAY 60-6583 (CHEBI:131358) has role adenosine A2B receptor agonist (CHEBI:131359) |
| BAY 60-6583 (CHEBI:131358) has role anti-inflammatory agent (CHEBI:67079) |
| BAY 60-6583 (CHEBI:131358) has role cardioprotective agent (CHEBI:77307) |
| BAY 60-6583 (CHEBI:131358) is a aminopyridine (CHEBI:38207) |
| BAY 60-6583 (CHEBI:131358) is a aromatic ether (CHEBI:35618) |
| BAY 60-6583 (CHEBI:131358) is a aryl sulfide (CHEBI:35683) |
| BAY 60-6583 (CHEBI:131358) is a cyanopyridine (CHEBI:23438) |
| BAY 60-6583 (CHEBI:131358) is a cyclopropanes (CHEBI:51454) |
| BAY 60-6583 (CHEBI:131358) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| 2-({6-amino-3,5-dicyano-4-[4-(cyclopropylmethoxy)phenyl]pyridin-2-yl}sulfanyl)acetamide |
| Manual Xrefs | Databases |
|---|---|
| BAY_60-6583 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15017054 | Reaxys |
| CAS:910487-58-0 | ChemIDplus |
| Citations |
|---|