EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O3 |
| Net Charge | 0 |
| Average Mass | 132.159 |
| Monoisotopic Mass | 132.07864 |
| SMILES | CCC(C(=O)O)C(C)O |
| InChI | InChI=1S/C6H12O3/c1-3-5(4(2)7)6(8)9/h4-5,7H,3H2,1-2H3,(H,8,9) |
| InChIKey | TYBSGNFITSHAJH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (26839171) | ||
| - | MetaboLights (MTBLS298) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethyl-3-hydroxybutyric acid (CHEBI:131354) is a 3-hydroxy monocarboxylic acid (CHEBI:35969) |
| 2-ethyl-3-hydroxybutyric acid (CHEBI:131354) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 2-ethyl-3-hydroxybutanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1751454 | Reaxys |