EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O3 |
| Net Charge | 0 |
| Average Mass | 144.170 |
| Monoisotopic Mass | 144.07864 |
| SMILES | CCC(=O)C(CC)C(=O)O |
| InChI | InChI=1S/C7H12O3/c1-3-5(7(9)10)6(8)4-2/h5H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | SDVJLFHTPKRNAH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | MetaboLights (MTBLS298) | ||
| - | PubMed (26839171) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-ethyl-3-ketopentanoic acid (CHEBI:131353) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| IUPAC Name |
|---|
| 2-ethyl-3-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| 2-ethyl-3-oxovaleric acid | ChEBI |
| 2-propanoylbutyric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2429198 | Reaxys |