EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8ClN5O |
| Net Charge | 0 |
| Average Mass | 285.694 |
| Monoisotopic Mass | 285.04174 |
| SMILES | Nc1nc2ccc(Cl)cc2c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C13H8ClN5O/c14-7-3-4-9-8(6-7)12-17-11(10-2-1-5-20-10)18-19(12)13(15)16-9/h1-6H,(H2,15,16) |
| InChIKey | MSJODEOZODDVGW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | adenosine A1 receptor antagonist An antagonist at the A1 receptor. adenosine A2A receptor antagonist An antagonist at the A2A receptor. |
| Applications: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CGS 15943 (CHEBI:131351) has role adenosine A1 receptor antagonist (CHEBI:63957) |
| CGS 15943 (CHEBI:131351) has role adenosine A2A receptor antagonist (CHEBI:53121) |
| CGS 15943 (CHEBI:131351) has role antineoplastic agent (CHEBI:35610) |
| CGS 15943 (CHEBI:131351) has role central nervous system stimulant (CHEBI:35337) |
| CGS 15943 (CHEBI:131351) is a aromatic amine (CHEBI:33860) |
| CGS 15943 (CHEBI:131351) is a biaryl (CHEBI:64459) |
| CGS 15943 (CHEBI:131351) is a furans (CHEBI:24129) |
| CGS 15943 (CHEBI:131351) is a organochlorine compound (CHEBI:36683) |
| CGS 15943 (CHEBI:131351) is a primary amino compound (CHEBI:50994) |
| CGS 15943 (CHEBI:131351) is a triazoloquinazoline (CHEBI:131355) |
| IUPAC Name |
|---|
| 9-chloro-2-(furan-2-yl)[1,2,4]triazolo[1,5-c]quinazolin-5-amine |
| Synonyms | Source |
|---|---|
| 9-Chloro-2-(2-furyl)-(1,2,4)triazolo(1,5-c)quinazolin-5-imine | ChemIDplus |
| CGS-15943 | ChEBI |
| CGS15943 | ChEBI |
| CGS 15943A | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CGS-15943 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4237267 | Reaxys |
| CAS:104615-18-1 | ChemIDplus |
| Citations |
|---|