EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H19F3N4O |
| Net Charge | 0 |
| Average Mass | 460.459 |
| Monoisotopic Mass | 460.15110 |
| SMILES | NCC(=O)Nc1ccc(-n2nc(C(F)(F)F)cc2-c2ccc3c(ccc4ccccc43)c2)cc1 |
| InChI | InChI=1S/C26H19F3N4O/c27-26(28,29)24-14-23(33(32-24)20-10-8-19(9-11-20)31-25(34)15-30)18-7-12-22-17(13-18)6-5-16-3-1-2-4-21(16)22/h1-14H,15,30H2,(H,31,34) |
| InChIKey | YULUCECVQOCQFQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| OSU-03012 (CHEBI:131196) has role antineoplastic agent (CHEBI:35610) |
| OSU-03012 (CHEBI:131196) has role apoptosis inducer (CHEBI:68495) |
| OSU-03012 (CHEBI:131196) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| OSU-03012 (CHEBI:131196) is a antibiotic antifungal drug (CHEBI:87113) |
| OSU-03012 (CHEBI:131196) is a aromatic amide (CHEBI:62733) |
| OSU-03012 (CHEBI:131196) is a glycine derivative (CHEBI:24373) |
| OSU-03012 (CHEBI:131196) is a organofluorine compound (CHEBI:37143) |
| OSU-03012 (CHEBI:131196) is a phenanthrenes (CHEBI:25961) |
| OSU-03012 (CHEBI:131196) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| N-{4-[5-(phenanthren-2-yl)-3-(trifluoromethyl)-1H-pyrazol-1-yl]phenyl}glycinamide |
| Synonyms | Source |
|---|---|
| AR-12 | ChemIDplus |
| PDK1 inhibitor AR-12 | ChemIDplus |
| OSU 03012 | ChemIDplus |
| AR 12 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| OSU-03012 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11001693 | Reaxys |
| CAS:742112-33-0 | ChemIDplus |
| Citations |
|---|