EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8I4O4 |
| Net Charge | 0 |
| Average Mass | 747.830 |
| Monoisotopic Mass | 747.66015 |
| SMILES | O=C(O)Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1 |
| InChI | InChI=1S/C14H8I4O4/c15-8-4-7(5-9(16)13(8)21)22-14-10(17)1-6(2-11(14)18)3-12(19)20/h1-2,4-5,21H,3H2,(H,19,20) |
| InChIKey | PPJYSSNKSXAVDB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | thyroid hormone Any hormone produced by the thyroid gland apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3',5,5'-tetraiodothyroacetic acid (CHEBI:131194) has role apoptosis inducer (CHEBI:68495) |
| 3,3',5,5'-tetraiodothyroacetic acid (CHEBI:131194) has role human metabolite (CHEBI:77746) |
| 3,3',5,5'-tetraiodothyroacetic acid (CHEBI:131194) has role thyroid hormone (CHEBI:60311) |
| 3,3',5,5'-tetraiodothyroacetic acid (CHEBI:131194) is a 2-halophenol (CHEBI:53291) |
| 3,3',5,5'-tetraiodothyroacetic acid (CHEBI:131194) is a aromatic ether (CHEBI:35618) |
| 3,3',5,5'-tetraiodothyroacetic acid (CHEBI:131194) is a iodophenol (CHEBI:24863) |
| 3,3',5,5'-tetraiodothyroacetic acid (CHEBI:131194) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| 3,5-Diiodo-4-(4-hydroxy-3,5-diiodophenoxy)benzeneacetic acid | ChemIDplus |
| Acide 3,5,3',5'-tetraiodothyroacetique | ChemIDplus |
| Tetrac | ChemIDplus |
| Tetraiodothyroacetic acid | ChemIDplus |
| Citations |
|---|