EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O2 |
| Net Charge | 0 |
| Average Mass | 282.383 |
| Monoisotopic Mass | 282.16198 |
| SMILES | [H][C@@]12C=CC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H22O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3-4,7,9,11,14-16H,5-6,8,10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 |
| InChIKey | DKVSUQWCZQBWCP-QAGGRKNESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| androsta-1,4,6-triene-3,17-dione (CHEBI:131190) has role EC 1.14.14.14 (aromatase) inhibitor (CHEBI:50790) |
| androsta-1,4,6-triene-3,17-dione (CHEBI:131190) has role human xenobiotic metabolite (CHEBI:76967) |
| androsta-1,4,6-triene-3,17-dione (CHEBI:131190) is a 17-oxo steroid (CHEBI:19168) |
| androsta-1,4,6-triene-3,17-dione (CHEBI:131190) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| androsta-1,4,6-triene-3,17-dione (CHEBI:131190) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| androsta-1,4,6-triene-3,17-dione |
| Synonyms | Source |
|---|---|
| 1,4,6-Etioallochan-dione | ChemIDplus |
| 1,4,6-Androstatriene-3,17-dione | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1,4,6-Androstatriene-3,17-dione | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3121300 | Reaxys |
| CAS:633-35-2 | ChemIDplus |
| Citations |
|---|