EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O2 |
| Net Charge | 0 |
| Average Mass | 282.383 |
| Monoisotopic Mass | 282.16198 |
| SMILES | [H][C@@]12C=CC3=CC(=O)C=C[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H22O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3-4,7,9,11,14-16H,5-6,8,10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1 |
| InChIKey | DKVSUQWCZQBWCP-QAGGRKNESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| androsta-1,4,6-triene-3,17-dione (CHEBI:131190) has role EC 1.14.14.14 (aromatase) inhibitor (CHEBI:50790) |
| androsta-1,4,6-triene-3,17-dione (CHEBI:131190) has role human xenobiotic metabolite (CHEBI:76967) |
| androsta-1,4,6-triene-3,17-dione (CHEBI:131190) is a 17-oxo steroid (CHEBI:19168) |
| androsta-1,4,6-triene-3,17-dione (CHEBI:131190) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| androsta-1,4,6-triene-3,17-dione (CHEBI:131190) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| androsta-1,4,6-triene-3,17-dione |
| Synonyms | Source |
|---|---|
| 1,4,6-Androstatriene-3,17-dione | ChemIDplus |
| 1,4,6-Etioallochan-dione | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1,4,6-Androstatriene-3,17-dione | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3121300 | Reaxys |
| CAS:633-35-2 | ChemIDplus |
| Citations |
|---|