EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16BNO |
| Net Charge | 0 |
| Average Mass | 225.100 |
| Monoisotopic Mass | 225.13249 |
| SMILES | NCCOB(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H16BNO/c16-11-12-17-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,16H2 |
| InChIKey | BLZVCIGGICSWIG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. IP3 receptor antagonist An antagonist that binds to and deactivates IP3 receptors. potassium channel opener A potassium channel modulator that opens the potassium channel. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminoethoxydiphenylborane (CHEBI:131184) has role calcium channel blocker (CHEBI:38215) |
| 2-aminoethoxydiphenylborane (CHEBI:131184) has role IP3 receptor antagonist (CHEBI:131186) |
| 2-aminoethoxydiphenylborane (CHEBI:131184) has role potassium channel opener (CHEBI:79085) |
| 2-aminoethoxydiphenylborane (CHEBI:131184) is a organoboron compound (CHEBI:38278) |
| 2-aminoethoxydiphenylborane (CHEBI:131184) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| 2-aminoethyl diphenylborinate |
| Synonyms | Source |
|---|---|
| 2-Aminoethyl diphenylborinate | KEGG COMPOUND |
| 2-APB | KEGG COMPOUND |
| B-(2-Aminoethoxy)diphenylborane | ChEBI |
| o-(2-Aminoethyl)diphenylborinic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2-Aminoethoxydiphenyl_borate | Wikipedia |
| C20698 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2942273 | Reaxys |
| CAS:524-95-8 | ChemIDplus |
| CAS:524-95-8 | KEGG COMPOUND |
| Citations |
|---|