EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16BNO |
| Net Charge | 0 |
| Average Mass | 225.100 |
| Monoisotopic Mass | 225.13249 |
| SMILES | NCCOB(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H16BNO/c16-11-12-17-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,16H2 |
| InChIKey | BLZVCIGGICSWIG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | IP3 receptor antagonist An antagonist that binds to and deactivates IP3 receptors. potassium channel opener A potassium channel modulator that opens the potassium channel. calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminoethoxydiphenylborane (CHEBI:131184) has role calcium channel blocker (CHEBI:38215) |
| 2-aminoethoxydiphenylborane (CHEBI:131184) has role IP3 receptor antagonist (CHEBI:131186) |
| 2-aminoethoxydiphenylborane (CHEBI:131184) has role potassium channel opener (CHEBI:79085) |
| 2-aminoethoxydiphenylborane (CHEBI:131184) is a organoboron compound (CHEBI:38278) |
| 2-aminoethoxydiphenylborane (CHEBI:131184) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| 2-aminoethyl diphenylborinate |
| Synonyms | Source |
|---|---|
| 2-APB | KEGG COMPOUND |
| 2-Aminoethyl diphenylborinate | KEGG COMPOUND |
| o-(2-Aminoethyl)diphenylborinic acid | ChEBI |
| B-(2-Aminoethoxy)diphenylborane | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C20698 | KEGG COMPOUND |
| 2-Aminoethoxydiphenyl_borate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2942273 | Reaxys |
| CAS:524-95-8 | KEGG COMPOUND |
| CAS:524-95-8 | ChemIDplus |
| Citations |
|---|