EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26FN3O2 |
| Net Charge | 0 |
| Average Mass | 383.467 |
| Monoisotopic Mass | 383.20091 |
| SMILES | Cc1c(F)cc(C(=O)NC2CC2)cc1-c1ccc(C(=O)NCC(C)(C)C)cn1 |
| InChI | InChI=1S/C22H26FN3O2/c1-13-17(9-15(10-18(13)23)21(28)26-16-6-7-16)19-8-5-14(11-24-19)20(27)25-12-22(2,3)4/h5,8-11,16H,6-7,12H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | KKYABQBFGDZVNQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| Applications: | nootropic agent Any compound that improves mental functions such as cognition, memory, intelligence, motivation, attention, and concentration. anti-inflammatory agent Any compound that has anti-inflammatory effects. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| losmapimod (CHEBI:131167) has role anti-inflammatory agent (CHEBI:67079) |
| losmapimod (CHEBI:131167) has role cardioprotective agent (CHEBI:77307) |
| losmapimod (CHEBI:131167) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| losmapimod (CHEBI:131167) has role nootropic agent (CHEBI:66980) |
| losmapimod (CHEBI:131167) is a benzamides (CHEBI:22702) |
| losmapimod (CHEBI:131167) is a cyclopropanes (CHEBI:51454) |
| losmapimod (CHEBI:131167) is a monofluorobenzenes (CHEBI:83575) |
| losmapimod (CHEBI:131167) is a phenylpyridine (CHEBI:38193) |
| losmapimod (CHEBI:131167) is a pyridinecarboxamide (CHEBI:25529) |
| losmapimod (CHEBI:131167) is a secondary carboxamide (CHEBI:140325) |
| losmapimod (CHEBI:131167) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| 6-[5-(cyclopropylcarbamoyl)-3-fluoro-2-methylphenyl]-N-(2,2-dimethylpropyl)pyridine-3-carboxamide |
| INNs | Source |
|---|---|
| losmapimod | WHO MedNet |
| losmapimod | WHO MedNet |
| losmapimod | WHO MedNet |
| losmapimodum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 6-[5-[(cyclopropylamino)-oxomethyl]-3-fluoro-2-methylphenyl]-N-(2,2-dimethylpropyl)-3-pyridinecarboxamide | ChEBI |
| GW856553 | DrugBank |
| GW-856553X | DrugBank |
| GW856553X | DrugBank |
| 6-(5-((cyclopropylamino)carbonyl)-3-fluoro-2-methylphenyl)-N-(2,2-dimethylpropyl)-3-pyridinecarboxamide | ChEBI |
| GSK-AHAB | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-42767 | LINCS |
| DB12270 | DrugBank |
| D09639 | KEGG DRUG |
| Losmapimod | Wikipedia |
| HMDB0254167 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:585543-15-3 | KEGG DRUG |
| Citations |
|---|