EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26FN3O2 |
| Net Charge | 0 |
| Average Mass | 383.467 |
| Monoisotopic Mass | 383.20091 |
| SMILES | Cc1c(F)cc(C(=O)NC2CC2)cc1-c1ccc(C(=O)NCC(C)(C)C)cn1 |
| InChI | InChI=1S/C22H26FN3O2/c1-13-17(9-15(10-18(13)23)21(28)26-16-6-7-16)19-8-5-14(11-24-19)20(27)25-12-22(2,3)4/h5,8-11,16H,6-7,12H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | KKYABQBFGDZVNQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. nootropic agent Any compound that improves mental functions such as cognition, memory, intelligence, motivation, attention, and concentration. cardioprotective agent Any protective agent that is able to prevent damage to the heart. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-inflammatory agent Any compound that has anti-inflammatory effects. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| losmapimod (CHEBI:131167) has role anti-inflammatory agent (CHEBI:67079) |
| losmapimod (CHEBI:131167) has role antiatherosclerotic agent (CHEBI:145947) |
| losmapimod (CHEBI:131167) has role antidepressant (CHEBI:35469) |
| losmapimod (CHEBI:131167) has role antirheumatic drug (CHEBI:35842) |
| losmapimod (CHEBI:131167) has role antiviral agent (CHEBI:22587) |
| losmapimod (CHEBI:131167) has role cardioprotective agent (CHEBI:77307) |
| losmapimod (CHEBI:131167) has role cardiovascular drug (CHEBI:35554) |
| losmapimod (CHEBI:131167) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| losmapimod (CHEBI:131167) has role nootropic agent (CHEBI:66980) |
| losmapimod (CHEBI:131167) is a benzamides (CHEBI:22702) |
| losmapimod (CHEBI:131167) is a cyclopropanes (CHEBI:51454) |
| losmapimod (CHEBI:131167) is a monofluorobenzenes (CHEBI:83575) |
| losmapimod (CHEBI:131167) is a phenylpyridine (CHEBI:38193) |
| losmapimod (CHEBI:131167) is a pyridinecarboxamide (CHEBI:25529) |
| losmapimod (CHEBI:131167) is a secondary carboxamide (CHEBI:140325) |
| losmapimod (CHEBI:131167) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| 6-[5-(cyclopropylcarbamoyl)-3-fluoro-2-methylphenyl]-N-(2,2-dimethylpropyl)pyridine-3-carboxamide |
| INNs | Source |
|---|---|
| losmapimod | WHO MedNet |
| losmapimod | WHO MedNet |
| losmapimod | WHO MedNet |
| losmapimodum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 6-(5-((cyclopropylamino)carbonyl)-3-fluoro-2-methylphenyl)-N-(2,2-dimethylpropyl)-3-pyridinecarboxamide | ChEBI |
| 6-[5-[(cyclopropylamino)carbonyl]-3-fluoro-2-methylphenyl]-N-(2,2-dimethylpropyl)-3-pyridinecarboxamide | ChEBI |
| 6-[5-[(cyclopropylamino)-oxomethyl]-3-fluoro-2-methylphenyl]-N-(2,2-dimethylpropyl)-3-pyridinecarboxamide | ChEBI |
| 6-[5-(cyclopropylcarbamoyl)-3-fluoro-2-methylphenyl]-N-(2,2-dimethylpropyl)nicotinamide | ChEBI |
| FTX 1821 | ChEBI |
| FTX-1821 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D09639 | KEGG DRUG |
| DB12270 | DrugBank |
| HMDB0254167 | HMDB |
| Losmapimod | Wikipedia |
| LSM-42767 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:585543-15-3 | KEGG DRUG |
| Citations |
|---|