EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26FN3O2 |
| Net Charge | 0 |
| Average Mass | 383.467 |
| Monoisotopic Mass | 383.20091 |
| SMILES | Cc1c(F)cc(C(=O)NC2CC2)cc1-c1ccc(C(=O)NCC(C)(C)C)cn1 |
| InChI | InChI=1S/C22H26FN3O2/c1-13-17(9-15(10-18(13)23)21(28)26-16-6-7-16)19-8-5-14(11-24-19)20(27)25-12-22(2,3)4/h5,8-11,16H,6-7,12H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | KKYABQBFGDZVNQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. cardioprotective agent Any protective agent that is able to prevent damage to the heart. nootropic agent Any compound that improves mental functions such as cognition, memory, intelligence, motivation, attention, and concentration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| losmapimod (CHEBI:131167) has role anti-inflammatory agent (CHEBI:67079) |
| losmapimod (CHEBI:131167) has role cardioprotective agent (CHEBI:77307) |
| losmapimod (CHEBI:131167) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| losmapimod (CHEBI:131167) has role nootropic agent (CHEBI:66980) |
| losmapimod (CHEBI:131167) is a benzamides (CHEBI:22702) |
| losmapimod (CHEBI:131167) is a cyclopropanes (CHEBI:51454) |
| losmapimod (CHEBI:131167) is a monofluorobenzenes (CHEBI:83575) |
| losmapimod (CHEBI:131167) is a phenylpyridine (CHEBI:38193) |
| losmapimod (CHEBI:131167) is a pyridinecarboxamide (CHEBI:25529) |
| losmapimod (CHEBI:131167) is a secondary carboxamide (CHEBI:140325) |
| losmapimod (CHEBI:131167) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| 6-[5-(cyclopropylcarbamoyl)-3-fluoro-2-methylphenyl]-N-(2,2-dimethylpropyl)pyridine-3-carboxamide |
| INNs | Source |
|---|---|
| losmapimod | WHO MedNet |
| losmapimod | WHO MedNet |
| losmapimod | WHO MedNet |
| losmapimodum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 6-(5-((cyclopropylamino)carbonyl)-3-fluoro-2-methylphenyl)-N-(2,2-dimethylpropyl)-3-pyridinecarboxamide | ChEBI |
| 6-[5-[(cyclopropylamino)carbonyl]-3-fluoro-2-methylphenyl]-N-(2,2-dimethylpropyl)-3-pyridinecarboxamide | ChEBI |
| 6-[5-[(cyclopropylamino)-oxomethyl]-3-fluoro-2-methylphenyl]-N-(2,2-dimethylpropyl)-3-pyridinecarboxamide | ChEBI |
| 6-[5-(cyclopropylcarbamoyl)-3-fluoro-2-methylphenyl]-N-(2,2-dimethylpropyl)nicotinamide | ChEBI |
| FTX 1821 | ChEBI |
| FTX1821 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D09639 | KEGG DRUG |
| DB12270 | DrugBank |
| HMDB0254167 | HMDB |
| Losmapimod | Wikipedia |
| LSM-42767 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:585543-15-3 | KEGG DRUG |
| Citations |
|---|