EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26F6N4O3 |
| Net Charge | 0 |
| Average Mass | 556.507 |
| Monoisotopic Mass | 556.19091 |
| SMILES | CN1C(=O)[C@@H](NC(=O)[C@H](CCC(F)(F)F)[C@H](CCC(F)(F)F)C(N)=O)N=C(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C26H26F6N4O3/c1-36-19-10-6-5-9-18(19)20(15-7-3-2-4-8-15)34-22(24(36)39)35-23(38)17(12-14-26(30,31)32)16(21(33)37)11-13-25(27,28)29/h2-10,16-17,22H,11-14H2,1H3,(H2,33,37)(H,35,38)/t16-,17+,22+/m0/s1 |
| InChIKey | AYOUDDAETNMCBW-GSHUGGBRSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3R)-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2,3-bis(3,3,3-trifluoropropyl)butanediamide (CHEBI:131164) has role antineoplastic agent (CHEBI:35610) |
| (2S,3R)-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2,3-bis(3,3,3-trifluoropropyl)butanediamide (CHEBI:131164) is a primary carboxamide (CHEBI:140324) |
| (2S,3R)-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2,3-bis(3,3,3-trifluoropropyl)butanediamide (CHEBI:131164) is a secondary carboxamide (CHEBI:140325) |
| (2S,3R)-N'-[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]-2,3-bis(3,3,3-trifluoropropyl)butanediamide (CHEBI:131164) is a tertiary carboxamide (CHEBI:140326) |
| INN | Source |
|---|---|
| osugacestat | WHO MedNet |
| Synonyms | Source |
|---|---|
| AL-101 | ChEMBL |
| AL101 | ChEMBL |
| BM-0018 | ChEMBL |
| BM0018 | ChEMBL |
| BMS 906024 | ChEMBL |
| BMS-906024 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| LSM-42763 | LINCS |
| Citations |
|---|