EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19FN4O |
| Net Charge | 0 |
| Average Mass | 362.408 |
| Monoisotopic Mass | 362.15429 |
| SMILES | Nc1cc(F)ccc1NC(=O)/C=C/c1cnn(C/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C21H19FN4O/c22-18-9-10-20(19(23)13-18)25-21(27)11-8-17-14-24-26(15-17)12-4-7-16-5-2-1-3-6-16/h1-11,13-15H,12,23H2,(H,25,27)/b7-4+,11-8+ |
| InChIKey | BLVQHYHDYFTPDV-VCABWLAWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RGFP966 (CHEBI:131163) has role anti-inflammatory agent (CHEBI:67079) |
| RGFP966 (CHEBI:131163) has role antidepressant (CHEBI:35469) |
| RGFP966 (CHEBI:131163) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| RGFP966 (CHEBI:131163) has role neuroprotective agent (CHEBI:63726) |
| RGFP966 (CHEBI:131163) is a aromatic amide (CHEBI:62733) |
| RGFP966 (CHEBI:131163) is a enamide (CHEBI:51751) |
| RGFP966 (CHEBI:131163) is a monofluorobenzenes (CHEBI:83575) |
| RGFP966 (CHEBI:131163) is a pyrazoles (CHEBI:26410) |
| RGFP966 (CHEBI:131163) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| (2E)-N-(2-amino-4-fluorophenyl)-3-{1-[(2E)-3-phenylprop-2-en-1-yl]-1H-pyrazol-4-yl}prop-2-enamide |
| Synonyms | Source |
|---|---|
| (2E)-N-(2-amino-4-fluorophenyl)-3-[(2E)-1-(3-phenyl-2-propen-1-yl)-1H-pyrazol-4-yl]-2-propenamide | ChEBI |
| (E)-N-(2-amino-4-fluorophenyl)-3-(1-cinnamyl-1H-pyrazol-4-yl)acrylamide | ChEBI |
| RGFP 966 | ChEBI |
| RGFP-966 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1396841-57-8 | ChEBI |
| Citations |
|---|