EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:131156 - AZD7762
| Formula | C17H19FN4O2S |
| Net Charge | 0 |
| Average Mass | 362.430 |
| Monoisotopic Mass | 362.12128 |
| SMILES | NC(=O)Nc1cc(-c2cccc(F)c2)sc1C(=O)N[C@H]1CCCNC1 |
| InChI | InChI=1S/C17H19FN4O2S/c18-11-4-1-3-10(7-11)14-8-13(22-17(19)24)15(25-14)16(23)21-12-5-2-6-20-9-12/h1,3-4,7-8,12,20H,2,5-6,9H2,(H,21,23)(H3,19,22,24)/t12-/m0/s1 |
| InChIKey | IAYGCINLNONXHY-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AZD7762 (CHEBI:131156) has role antineoplastic agent (CHEBI:35610) |
| AZD7762 (CHEBI:131156) has role apoptosis inducer (CHEBI:68495) |
| AZD7762 (CHEBI:131156) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| AZD7762 (CHEBI:131156) is a aromatic amide (CHEBI:62733) |
| AZD7762 (CHEBI:131156) is a monofluorobenzenes (CHEBI:83575) |
| AZD7762 (CHEBI:131156) is a piperidines (CHEBI:26151) |
| AZD7762 (CHEBI:131156) is a secondary carboxamide (CHEBI:140325) |
| AZD7762 (CHEBI:131156) is a thiophenes (CHEBI:26961) |
| AZD7762 (CHEBI:131156) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 3-(carbamoylamino)-5-(3-fluorophenyl)-N-[(3S)-piperidin-3-yl]thiophene-2-carboxamide |
| Synonyms | Source |
|---|---|
| 3-(carbamoylamino)-5-(3-fluorophenyl)-N-[(3S)-3-piperidinyl]-2-thiophenecarboxamide | ChEBI |
| AZD 7762 | ChEBI |
| AZD-7762 | ChEBI |
| 5-(3-fluorophenyl)-N-(piperidin-3-yl)-3-ureidothiophene-2-carboxamide | ChEBI |
| 5-(3-fluorophenyl)-3-ureidothiophene-2-carboxylic acid N-[(S)-piperidin-3-yl]amide | ChEBI |
| 3-[(aminocarbonyl)amino]-5-(3-fluorophenyl)-N-(3S)-3-piperidinyl-2-thiophenecarboxamide | ChEBI |
| Citations |
|---|