EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46O12 |
| Net Charge | 0 |
| Average Mass | 586.675 |
| Monoisotopic Mass | 586.29893 |
| SMILES | [H][C@@]12CC[C@]3(O)C[C@@H](O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)C[C@@H](O)[C@]3(CO)[C@@]1([H])[C@H](O)C[C@@]1(C)[C@]2(O)CC[C@]1([H])C1COC(=O)C1 |
| InChI | InChI=1S/C29H46O12/c1-13-22(34)23(35)24(36)25(40-13)41-15-8-19(32)28(12-30)21-17(3-5-27(28,37)9-15)29(38)6-4-16(14-7-20(33)39-11-14)26(29,2)10-18(21)31/h13-19,21-25,30-32,34-38H,3-12H2,1-2H3/t13-,14?,15-,16+,17+,18+,19+,21+,22-,23+,24+,25-,26+,27-,28+,29-/m0/s1 |
| InChIKey | ZTFGOPUOTATSAL-CFVDWFIMSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of Na+/K+-transporting ATPase (EC 3.6.3.9). |
| Applications: | radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroouabain (CHEBI:131146) has functional parent ouabain (CHEBI:472805) |
| dihydroouabain (CHEBI:131146) has role EC 3.6.3.9 (Na+/K+-transporting ATPase) inhibitor (CHEBI:63510) |
| dihydroouabain (CHEBI:131146) has role radiosensitizing agent (CHEBI:132992) |
| dihydroouabain (CHEBI:131146) is a cardenolide glycoside (CHEBI:38092) |
| IUPAC Name |
|---|
| (20ξ)-3β-[(6-deoxy-α-L-mannopyranosyl)oxy]-1β,5,11α,14,19-pentahydroxy-5β-cardanolide |
| Synonyms | Source |
|---|---|
| (1β,3β,5β,11α,20ξ)-3-[(6-deoxy-α-L-mannopyranosyl)oxy]-1,5,11,14,19-pentahydroxycardanolide | ChEBI |
| 3β-[(6-deoxy-α-L-mannopyranosyl)oxy]-1β,5,11α,14,19-pentahydroxy-5β,20ξ-cardanolide | ChEBI |
| dihydro-g-strophanthin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| dihydroouabain | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0251322 | HMDB |
| LSM-42697 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:71786 | Reaxys |
| CAS:1183-35-3 | ChemIDplus |
| Citations |
|---|