EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29N3O3 |
| Net Charge | 0 |
| Average Mass | 371.481 |
| Monoisotopic Mass | 371.22089 |
| SMILES | CCCC(=O)N1CCC2(CC1)CN[C@H](CO)c1nc3cc(OC)ccc3c12 |
| InChI | InChI=1S/C21H29N3O3/c1-3-4-18(26)24-9-7-21(8-10-24)13-22-17(12-25)20-19(21)15-6-5-14(27-2)11-16(15)23-20/h5-6,11,17,22-23,25H,3-4,7-10,12-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | SAXTURHULWJRBV-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(1S)-1-(hydroxymethyl)-7-methoxy-1'-spiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,4'-piperidine]yl]-1-butanone (CHEBI:131058) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-42606 | LINCS |