EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33N3O4S2 |
| Net Charge | 0 |
| Average Mass | 515.701 |
| Monoisotopic Mass | 515.19125 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@@H](CO)N(CC1CC1)CC31CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C26H33N3O4S2/c1-27-21-14-19(33-2)7-8-20(21)24-25(27)22(16-30)28(15-18-5-6-18)17-26(24)9-11-29(12-10-26)35(31,32)23-4-3-13-34-23/h3-4,7-8,13-14,18,22,30H,5-6,9-12,15-17H2,1-2H3/t22-/m1/s1 |
| InChIKey | CUXVMBOQZOKJID-JOCHJYFZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1S)-2-(cyclopropylmethyl)-7-methoxy-9-methyl-1'-thiophen-2-ylsulfonyl-1-spiro[1,3-dihydropyrido[3,4-b]indole-4,4'-piperidine]yl]methanol (CHEBI:130970) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-42518 | LINCS |