EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H35N3O4 |
| Net Charge | 0 |
| Average Mass | 465.594 |
| Monoisotopic Mass | 465.26276 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@@H](CO)N(C(=O)C1CCCC1)CC31CN(C(=O)CC2CC2)C1 |
| InChI | InChI=1S/C27H35N3O4/c1-28-21-12-19(34-2)9-10-20(21)24-25(28)22(13-31)30(26(33)18-5-3-4-6-18)16-27(24)14-29(15-27)23(32)11-17-7-8-17/h9-10,12,17-18,22,31H,3-8,11,13-16H2,1-2H3/t22-/m1/s1 |
| InChIKey | BNKASBYUNURLAO-JOCHJYFZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(1S)-2-[cyclopentyl(oxo)methyl]-1-(hydroxymethyl)-7-methoxy-9-methyl-1'-spiro[1,3-dihydropyrido[3,4-b]indole-4,3'-azetidine]yl]-2-cyclopropylethanone (CHEBI:130871) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-42420 | LINCS |