EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25N3O4S |
| Net Charge | 0 |
| Average Mass | 427.526 |
| Monoisotopic Mass | 427.15658 |
| SMILES | COc1ccc2c3c(nc2c1)[C@@H](CO)NCC31CN(S(=O)(=O)c2cccc(C)c2)C1 |
| InChI | InChI=1S/C22H25N3O4S/c1-14-4-3-5-16(8-14)30(27,28)25-12-22(13-25)11-23-19(10-26)21-20(22)17-7-6-15(29-2)9-18(17)24-21/h3-9,19,23-24,26H,10-13H2,1-2H3/t19-/m1/s1 |
| InChIKey | VUGNYPCFYXWXRZ-LJQANCHMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1S)-7-methoxy-1'-(3-methylphenyl)sulfonyl-1-spiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,3'-azetidine]yl]methanol (CHEBI:130868) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-42417 | LINCS |