EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6NO3 |
| Net Charge | -1 |
| Average Mass | 116.096 |
| Monoisotopic Mass | 116.03532 |
| SMILES | [H]C(=O)C[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C4H7NO3/c5-3(1-2-6)4(7)8/h2-3H,1,5H2,(H,7,8)/p-1/t3-/m0/s1 |
| InChIKey | HOSWPDPVFBCLSY-VKHMYHEASA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-aspartate 4-semialdehyde (CHEBI:13086) has functional parent L-aspartate(1−) (CHEBI:29991) |
| L-aspartate 4-semialdehyde (CHEBI:13086) is a α-amino-acid anion (CHEBI:33558) |
| L-aspartate 4-semialdehyde (CHEBI:13086) is conjugate base of L-aspartic 4-semialdehyde (CHEBI:18051) |
| Incoming Relation(s) |
| L-aspartic 4-semialdehyde (CHEBI:18051) is conjugate acid of L-aspartate 4-semialdehyde (CHEBI:13086) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-oxobutanoate |
| Synonyms | Source |
|---|---|
| Aspartate beta-semialdehyde | KEGG COMPOUND |
| L-Aspartate 4-semialdehyde | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00441 | KEGG COMPOUND |