EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29N3O3 |
| Net Charge | 0 |
| Average Mass | 419.525 |
| Monoisotopic Mass | 419.22089 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@@H](CO)N(C(=O)Cc1ccccc1)CC31CN(C)C1 |
| InChI | InChI=1S/C25H29N3O3/c1-26-14-25(15-26)16-28(22(30)11-17-7-5-4-6-8-17)21(13-29)24-23(25)19-10-9-18(31-3)12-20(19)27(24)2/h4-10,12,21,29H,11,13-16H2,1-3H3/t21-/m1/s1 |
| InChIKey | KLFBAQLYBKDDIQ-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(1S)-1-(hydroxymethyl)-7-methoxy-1',9-dimethyl-2-spiro[1,3-dihydropyrido[3,4-b]indole-4,3'-azetidine]yl]-2-phenylethanone (CHEBI:130743) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-42292 | LINCS |