EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H39N3O4 |
| Net Charge | 0 |
| Average Mass | 481.637 |
| Monoisotopic Mass | 481.29406 |
| SMILES | COc1ccc2c3c(nc2c1)[C@@H](CO)N(CC1CCCCC1)CC31CN(C(=O)C2CCOCC2)C1 |
| InChI | InChI=1S/C28H39N3O4/c1-34-21-7-8-22-23(13-21)29-26-24(15-32)30(14-19-5-3-2-4-6-19)16-28(25(22)26)17-31(18-28)27(33)20-9-11-35-12-10-20/h7-8,13,19-20,24,29,32H,2-6,9-12,14-18H2,1H3/t24-/m1/s1 |
| InChIKey | WAYFAYLWZGJUBM-XMMPIXPASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1S)-2-(cyclohexylmethyl)-1-(hydroxymethyl)-7-methoxy-1'-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,3'-azetidine]yl]-(4-oxanyl)methanone (CHEBI:130570) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-42119 | LINCS |