EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32ClN3O3 |
| Net Charge | 0 |
| Average Mass | 482.024 |
| Monoisotopic Mass | 481.21322 |
| SMILES | CCC(=O)N1CC2(CCN(Cc3ccccc3Cl)CC2)c2c(nc3cc(OC)ccc23)[C@H]1CO |
| InChI | InChI=1S/C27H32ClN3O3/c1-3-24(33)31-17-27(10-12-30(13-11-27)15-18-6-4-5-7-21(18)28)25-20-9-8-19(34-2)14-22(20)29-26(25)23(31)16-32/h4-9,14,23,29,32H,3,10-13,15-17H2,1-2H3/t23-/m1/s1 |
| InChIKey | OHNLIOCTEKXPSN-HSZRJFAPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(1S)-1'-[(2-chlorophenyl)methyl]-1-(hydroxymethyl)-7-methoxy-2-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]yl]-1-propanone (CHEBI:130566) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-42115 | LINCS |