EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30F2N4O3 |
| Net Charge | 0 |
| Average Mass | 496.558 |
| Monoisotopic Mass | 496.22860 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@@H](CO)N(CC1CC1)CC31CN(C(=O)Nc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C27H30F2N4O3/c1-31-22-10-18(36-2)6-7-19(22)24-25(31)23(12-34)32(11-16-3-4-16)13-27(24)14-33(15-27)26(35)30-21-8-5-17(28)9-20(21)29/h5-10,16,23,34H,3-4,11-15H2,1-2H3,(H,30,35)/t23-/m1/s1 |
| InChIKey | ANGGGRIYABJACC-HSZRJFAPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-2-(cyclopropylmethyl)-N-(2,4-difluorophenyl)-1-(hydroxymethyl)-7-methoxy-9-methyl-1'-spiro[1,3-dihydropyrido[3,4-b]indole-4,3'-azetidine]carboxamide (CHEBI:130505) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-42054 | LINCS |