EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42N4O6 |
| Net Charge | 0 |
| Average Mass | 554.688 |
| Monoisotopic Mass | 554.31044 |
| SMILES | C[C@@H]1CN([C@H](C)CO)C(=O)c2cc(NC(=O)CCCN(C)C)ccc2O[C@H]1CN(C)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C30H42N4O6/c1-20-16-34(21(2)19-35)29(37)25-15-24(31-28(36)7-6-14-32(3)4)12-13-26(25)40-27(20)18-33(5)17-22-8-10-23(11-9-22)30(38)39/h8-13,15,20-21,27,35H,6-7,14,16-19H2,1-5H3,(H,31,36)(H,38,39)/t20-,21-,27+/m1/s1 |
| InChIKey | NGHZCWRCBPRMGW-GNMOFYLKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[[[(2R,3R)-8-[[4-(dimethylamino)-1-oxobutyl]amino]-5-[(2R)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-3,4-dihydro-2H-1,5-benzoxazocin-2-yl]methyl-methylamino]methyl]benzoic acid (CHEBI:130446) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-41995 | LINCS |