EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32N4O5S |
| Net Charge | 0 |
| Average Mass | 464.588 |
| Monoisotopic Mass | 464.20934 |
| SMILES | CCS(=O)(=O)N1CC2(CN(C(=O)NC(C)C)[C@H](CO)c3c2c2ccc(OC)cc2n3C)C1 |
| InChI | InChI=1S/C22H32N4O5S/c1-6-32(29,30)25-11-22(12-25)13-26(21(28)23-14(2)3)18(10-27)20-19(22)16-8-7-15(31-5)9-17(16)24(20)4/h7-9,14,18,27H,6,10-13H2,1-5H3,(H,23,28)/t18-/m1/s1 |
| InChIKey | RSUQALRHXNGDLT-GOSISDBHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-1'-ethylsulfonyl-1-(hydroxymethyl)-7-methoxy-9-methyl-N-propan-2-yl-2-spiro[1,3-dihydropyrido[3,4-b]indole-4,3'-azetidine]carboxamide (CHEBI:130440) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-41989 | LINCS |