EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H33FN4O4 |
| Net Charge | 0 |
| Average Mass | 508.594 |
| Monoisotopic Mass | 508.24858 |
| SMILES | CCCNC(=O)N1CC2(CCN(C(=O)c3cccc(F)c3)CC2)c2c(nc3cc(OC)ccc23)[C@@H]1CO |
| InChI | InChI=1S/C28H33FN4O4/c1-3-11-30-27(36)33-17-28(9-12-32(13-10-28)26(35)18-5-4-6-19(29)14-18)24-21-8-7-20(37-2)15-22(21)31-25(24)23(33)16-34/h4-8,14-15,23,31,34H,3,9-13,16-17H2,1-2H3,(H,30,36)/t23-/m0/s1 |
| InChIKey | AMRZZRHTSOWILQ-QHCPKHFHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R)-1'-[(3-fluorophenyl)-oxomethyl]-1-(hydroxymethyl)-7-methoxy-N-propyl-2-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]carboxamide (CHEBI:130342) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-41891 | LINCS |