EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H42N4O6 |
| Net Charge | 0 |
| Average Mass | 566.699 |
| Monoisotopic Mass | 566.31044 |
| SMILES | C[C@@H]1CN([C@@H](C)CO)C(=O)c2cccc(NC(=O)NC3CCCCC3)c2O[C@H]1CN(C)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C31H42N4O6/c1-20-16-35(21(2)19-36)29(37)25-10-7-11-26(33-31(40)32-24-8-5-4-6-9-24)28(25)41-27(20)18-34(3)17-22-12-14-23(15-13-22)30(38)39/h7,10-15,20-21,24,27,36H,4-6,8-9,16-19H2,1-3H3,(H,38,39)(H2,32,33,40)/t20-,21+,27+/m1/s1 |
| InChIKey | DHFYMYKOVLGPGL-BUEREQSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[[[(2R,3R)-10-[[(cyclohexylamino)-oxomethyl]amino]-5-[(2S)-1-hydroxypropan-2-yl]-3-methyl-6-oxo-3,4-dihydro-2H-1,5-benzoxazocin-2-yl]methyl-methylamino]methyl]benzoic acid (CHEBI:130235) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-41784 | LINCS |