EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | O=C(O)CCCC(O)/C=C/C=C\C/C=C\C/C=C\C/C=C\CCO |
| InChI | InChI=1S/C20H30O4/c21-18-13-11-9-7-5-3-1-2-4-6-8-10-12-15-19(22)16-14-17-20(23)24/h2-5,8-12,15,19,21-22H,1,6-7,13-14,16-18H2,(H,23,24)/b4-2-,5-3-,10-8-,11-9-,15-12+ |
| InChIKey | YKIUQPPQZSVUED-OBYDOTQASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,20-diHEPE (CHEBI:130073) has functional parent all-cis-5,8,11,14,17-icosapentaenoic acid (CHEBI:28364) |
| 5,20-diHEPE (CHEBI:130073) is a homoallylic alcohol (CHEBI:134362) |
| 5,20-diHEPE (CHEBI:130073) is a icosanoid (CHEBI:23899) |
| 5,20-diHEPE (CHEBI:130073) is a polyunsaturated fatty acid (CHEBI:26208) |
| 5,20-diHEPE (CHEBI:130073) is a secondary allylic alcohol (CHEBI:134396) |
| 5,20-diHEPE (CHEBI:130073) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| 5,20-diHEPE (CHEBI:130073) is conjugate acid of 5,20-diHEPE(1−) (CHEBI:91301) |
| Incoming Relation(s) |
| 5,20-diHEPE(1−) (CHEBI:91301) is conjugate base of 5,20-diHEPE (CHEBI:130073) |
| IUPAC Name |
|---|
| (6E,8Z,11Z,14Z,17Z)-5,20-dihydroxyicosa-6,8,11,14,17-pentaenoic acid |
| Synonyms | Source |
|---|---|
| (6E,8Z,11Z,14Z,17Z)-5,20-dihydroxyicosapentaenoic acid | ChEBI |
| 5,20-dihydroxy-(6E,8Z,11Z,14Z,17Z)-icosapentaenoic acid | ChEBI |
| 5,20-DHEPE | ChEBI |
| Citations |
|---|