EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31N3O4S |
| Net Charge | 0 |
| Average Mass | 469.607 |
| Monoisotopic Mass | 469.20353 |
| SMILES | COc1ccc2c3c(nc2c1)[C@H](CO)N(C)CC31CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C25H31N3O4S/c1-17-4-7-19(8-5-17)33(30,31)28-12-10-25(11-13-28)16-27(2)22(15-29)24-23(25)20-9-6-18(32-3)14-21(20)26-24/h4-9,14,22,26,29H,10-13,15-16H2,1-3H3/t22-/m0/s1 |
| InChIKey | IDTLSUBVBUIIPR-QFIPXVFZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1R)-7-methoxy-2-methyl-1'-(4-methylphenyl)sulfonyl-1-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]yl]methanol (CHEBI:130023) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-41574 | LINCS |