EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H29N5O4 |
| Net Charge | 0 |
| Average Mass | 463.538 |
| Monoisotopic Mass | 463.22195 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@@H](CO)N(C(C)=O)CC31CCN(C(=O)c2cnccn2)CC1 |
| InChI | InChI=1S/C25H29N5O4/c1-16(32)30-15-25(6-10-29(11-7-25)24(33)19-13-26-8-9-27-19)22-18-5-4-17(34-3)12-20(18)28(2)23(22)21(30)14-31/h4-5,8-9,12-13,21,31H,6-7,10-11,14-15H2,1-3H3/t21-/m1/s1 |
| InChIKey | SLZGQCVOMHOTHN-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[(1S)-1-(hydroxymethyl)-7-methoxy-9-methyl-1'-[oxo(2-pyrazinyl)methyl]-2-spiro[1,3-dihydropyrido[3,4-b]indole-4,4'-piperidine]yl]ethanone (CHEBI:129891) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-41442 | LINCS |