EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30N4O3 |
| Net Charge | 0 |
| Average Mass | 446.551 |
| Monoisotopic Mass | 446.23179 |
| SMILES | COc1ccc2c3c(nc2c1)[C@H](CO)N(Cc1ccccn1)CC31CN(C(=O)CC2CC2)C1 |
| InChI | InChI=1S/C26H30N4O3/c1-33-19-7-8-20-21(11-19)28-25-22(13-31)29(12-18-4-2-3-9-27-18)14-26(24(20)25)15-30(16-26)23(32)10-17-5-6-17/h2-4,7-9,11,17,22,28,31H,5-6,10,12-16H2,1H3/t22-/m0/s1 |
| InChIKey | ONCARCJPOIEUSJ-QFIPXVFZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-cyclopropyl-1-[(1R)-1-(hydroxymethyl)-7-methoxy-2-(2-pyridinylmethyl)-1'-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,3'-azetidine]yl]ethanone (CHEBI:129872) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-41423 | LINCS |