EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H34N4O5S |
| Net Charge | 0 |
| Average Mass | 478.615 |
| Monoisotopic Mass | 478.22499 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@@H](CO)N(C(=O)CN(C)C)CC31CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C23H34N4O5S/c1-24(2)13-20(29)27-15-23(8-10-26(11-9-23)33(5,30)31)21-17-7-6-16(32-4)12-18(17)25(3)22(21)19(27)14-28/h6-7,12,19,28H,8-11,13-15H2,1-5H3/t19-/m1/s1 |
| InChIKey | FSKDQLZOIAFXNF-LJQANCHMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(dimethylamino)-1-[(1S)-1-(hydroxymethyl)-7-methoxy-9-methyl-1'-methylsulfonyl-2-spiro[1,3-dihydropyrido[3,4-b]indole-4,4'-piperidine]yl]ethanone (CHEBI:129749) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-41300 | LINCS |