EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32FN5O4S |
| Net Charge | 0 |
| Average Mass | 553.660 |
| Monoisotopic Mass | 553.21590 |
| SMILES | COc1ccc2c3c(nc2c1)[C@@H](CO)N(S(=O)(=O)c1cn(C)cn1)CC31CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C28H32FN5O4S/c1-32-15-25(30-18-32)39(36,37)34-17-28(9-11-33(12-10-28)14-19-5-3-4-6-22(19)29)26-21-8-7-20(38-2)13-23(21)31-27(26)24(34)16-35/h3-8,13,15,18,24,31,35H,9-12,14,16-17H2,1-2H3/t24-/m1/s1 |
| InChIKey | INKSFZDGSMIVLV-XMMPIXPASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1S)-1'-[(2-fluorophenyl)methyl]-7-methoxy-2-[(1-methyl-4-imidazolyl)sulfonyl]-1-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,4'-piperidine]yl]methanol (CHEBI:129717) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-41268 | LINCS |