EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H28FN5O6 |
| Net Charge | 0 |
| Average Mass | 573.581 |
| Monoisotopic Mass | 573.20236 |
| SMILES | COc1ccc2c3c(nc2c1)[C@@H](CO)N(C(=O)Nc1ccc(F)cc1)CC31CN(C(=O)Nc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C30H28FN5O6/c1-40-20-7-8-21-22(11-20)34-27-23(12-37)36(29(39)32-18-4-2-17(31)3-5-18)15-30(26(21)27)13-35(14-30)28(38)33-19-6-9-24-25(10-19)42-16-41-24/h2-11,23,34,37H,12-16H2,1H3,(H,32,39)(H,33,38)/t23-/m1/s1 |
| InChIKey | MKCVBDBEIVTPQG-HSZRJFAPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-N1'-(1,3-benzodioxol-5-yl)-N2-(4-fluorophenyl)-1-(hydroxymethyl)-7-methoxyspiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,3'-azetidine]-1',2-dicarboxamide (CHEBI:129665) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-41216 | LINCS |