EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28FN3O2 |
| Net Charge | 0 |
| Average Mass | 409.505 |
| Monoisotopic Mass | 409.21656 |
| SMILES | COc1ccc2c3c(nc2c1)[C@@H](CO)NCC31CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H28FN3O2/c1-30-18-6-7-19-20(12-18)27-23-21(14-29)26-15-24(22(19)23)8-10-28(11-9-24)13-16-2-4-17(25)5-3-16/h2-7,12,21,26-27,29H,8-11,13-15H2,1H3/t21-/m1/s1 |
| InChIKey | RQYDDTBTNZKBCR-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1S)-1'-[(4-fluorophenyl)methyl]-7-methoxy-1-spiro[1,2,3,9-tetrahydropyrido[3,4-b]indole-4,4'-piperidine]yl]methanol (CHEBI:129657) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-41208 | LINCS |