EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28N6O4 |
| Net Charge | 0 |
| Average Mass | 464.526 |
| Monoisotopic Mass | 464.21720 |
| SMILES | CCCNC(=O)N1CC2(CN(C(=O)c3cnccn3)C2)c2c(nc3cc(OC)ccc23)[C@H]1CO |
| InChI | InChI=1S/C24H28N6O4/c1-3-6-27-23(33)30-14-24(12-29(13-24)22(32)18-10-25-7-8-26-18)20-16-5-4-15(34-2)9-17(16)28-21(20)19(30)11-31/h4-5,7-10,19,28,31H,3,6,11-14H2,1-2H3,(H,27,33)/t19-/m1/s1 |
| InChIKey | LBKLLFCFXJVMTQ-LJQANCHMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-1-(hydroxymethyl)-7-methoxy-1'-[oxo(2-pyrazinyl)methyl]-N-propyl-2-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,3'-azetidine]carboxamide (CHEBI:129418) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-40969 | LINCS |