EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32FN5O4 |
| Net Charge | 0 |
| Average Mass | 521.593 |
| Monoisotopic Mass | 521.24383 |
| SMILES | COc1ccc2c3c(nc2c1)[C@@H](CO)N(C(=O)NC1CCCC1)CC31CN(C(=O)Nc2cccc(F)c2)C1 |
| InChI | InChI=1S/C28H32FN5O4/c1-38-20-9-10-21-22(12-20)32-25-23(13-35)34(27(37)30-18-6-2-3-7-18)16-28(24(21)25)14-33(15-28)26(36)31-19-8-4-5-17(29)11-19/h4-5,8-12,18,23,32,35H,2-3,6-7,13-16H2,1H3,(H,30,37)(H,31,36)/t23-/m1/s1 |
| InChIKey | ANRYTLFYRFEVIA-HSZRJFAPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1S)-N2-cyclopentyl-N1'-(3-fluorophenyl)-1-(hydroxymethyl)-7-methoxyspiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,3'-azetidine]-1',2-dicarboxamide (CHEBI:129363) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-40914 | LINCS |