EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H35N3O5 |
| Net Charge | 0 |
| Average Mass | 517.626 |
| Monoisotopic Mass | 517.25767 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@@H](CO)N(CC1CC1)CC31CCN(C(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C30H35N3O5/c1-31-23-14-21(36-2)6-7-22(23)27-28(31)24(16-34)33(15-19-3-4-19)17-30(27)9-11-32(12-10-30)29(35)20-5-8-25-26(13-20)38-18-37-25/h5-8,13-14,19,24,34H,3-4,9-12,15-18H2,1-2H3/t24-/m1/s1 |
| InChIKey | JMQKFCXXDQUQRA-XMMPIXPASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3-benzodioxol-5-yl-[(1S)-2-(cyclopropylmethyl)-1-(hydroxymethyl)-7-methoxy-9-methyl-1'-spiro[1,3-dihydropyrido[3,4-b]indole-4,4'-piperidine]yl]methanone (CHEBI:129239) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-40790 | LINCS |