EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31N3O2 |
| Net Charge | 0 |
| Average Mass | 369.509 |
| Monoisotopic Mass | 369.24163 |
| SMILES | COc1ccc2c3c(nc2c1)[C@@H](CO)N(CC1CCCC1)CC31CN(C)C1 |
| InChI | InChI=1S/C22H31N3O2/c1-24-12-22(13-24)14-25(10-15-5-3-4-6-15)19(11-26)21-20(22)17-8-7-16(27-2)9-18(17)23-21/h7-9,15,19,23,26H,3-6,10-14H2,1-2H3/t19-/m1/s1 |
| InChIKey | SPSBXYBSNHZJTP-LJQANCHMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1S)-2-(cyclopentylmethyl)-7-methoxy-1'-methyl-1-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,3'-azetidine]yl]methanol (CHEBI:129197) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-40748 | LINCS |