EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12O5 |
| Net Charge | 0 |
| Average Mass | 152.146 |
| Monoisotopic Mass | 152.06847 |
| SMILES | OC[C@@H](O)C(O)[C@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[h122h]/1/ |
| InChI | InChI=1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | HEBKCHPVOIAQTA-QWWZWVQMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-arabinitol (CHEBI:18333) is a arabinitol (CHEBI:22605) |
| D-arabinitol (CHEBI:18333) is enantiomer of L-arabinitol (CHEBI:18403) |
| Incoming Relation(s) |
| D-arabinitol 1-phosphate (CHEBI:28455) has functional parent D-arabinitol (CHEBI:18333) |
| 2-carboxy-D-arabinitol (CHEBI:17077) has functional parent D-arabinitol (CHEBI:18333) |
| acremoauxin A (CHEBI:2431) has functional parent D-arabinitol (CHEBI:18333) |
| L-arabinitol (CHEBI:18403) is enantiomer of D-arabinitol (CHEBI:18333) |
| IUPAC Name |
|---|
| D-arabinitol |
| Synonyms | Source |
|---|---|
| D-Arabinitol | KEGG COMPOUND |
| D-Arabinol | KEGG COMPOUND |
| D-Arabitol | KEGG COMPOUND |
| D-Lyxitol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| D-arabinitol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00001156 | KNApSAcK |
| C01904 | KEGG COMPOUND |
| D-arabinitol | Wikipedia |
| HMDB0000568 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1720520 | Reaxys |
| CAS:488-82-4 | KEGG COMPOUND |
| Citations |
|---|