EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30FN3O2 |
| Net Charge | 0 |
| Average Mass | 435.543 |
| Monoisotopic Mass | 435.23221 |
| SMILES | COc1ccc2c3c(nc2c1)[C@H](CO)N(Cc1ccccc1F)CC31CN(CC2CC2)C1 |
| InChI | InChI=1S/C26H30FN3O2/c1-32-19-8-9-20-22(10-19)28-25-23(13-31)30(12-18-4-2-3-5-21(18)27)16-26(24(20)25)14-29(15-26)11-17-6-7-17/h2-5,8-10,17,23,28,31H,6-7,11-16H2,1H3/t23-/m0/s1 |
| InChIKey | JMZBJDDNBVRKTA-QHCPKHFHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1R)-1'-(cyclopropylmethyl)-2-[(2-fluorophenyl)methyl]-7-methoxy-1-spiro[3,9-dihydro-1H-pyrido[3,4-b]indole-4,3'-azetidine]yl]methanol (CHEBI:129094) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-40645 | LINCS |