EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H38FN5O4 |
| Net Charge | 0 |
| Average Mass | 563.674 |
| Monoisotopic Mass | 563.29078 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@H](CO)N(C(=O)Nc1ccc(F)cc1)CC31CCN(C(=O)NC2CCCC2)CC1 |
| InChI | InChI=1S/C31H38FN5O4/c1-35-25-17-23(41-2)11-12-24(25)27-28(35)26(18-38)37(30(40)34-22-9-7-20(32)8-10-22)19-31(27)13-15-36(16-14-31)29(39)33-21-5-3-4-6-21/h7-12,17,21,26,38H,3-6,13-16,18-19H2,1-2H3,(H,33,39)(H,34,40)/t26-/m0/s1 |
| InChIKey | KWGXIONTUQXQSV-SANMLTNESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R)-N1'-cyclopentyl-N2-(4-fluorophenyl)-1-(hydroxymethyl)-7-methoxy-9-methylspiro[1,3-dihydropyrido[3,4-b]indole-4,4'-piperidine]-1',2-dicarboxamide (CHEBI:128831) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-40383 | LINCS |