EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H36N4O4S |
| Net Charge | 0 |
| Average Mass | 560.720 |
| Monoisotopic Mass | 560.24573 |
| SMILES | COc1ccc2c3c(n(C)c2c1)[C@@H](CO)N(S(=O)(=O)c1ccc(C)cc1)CC31CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C31H36N4O4S/c1-22-6-9-25(10-7-22)40(37,38)35-21-31(12-15-34(16-13-31)19-23-5-4-14-32-18-23)29-26-11-8-24(39-3)17-27(26)33(2)30(29)28(35)20-36/h4-11,14,17-18,28,36H,12-13,15-16,19-21H2,1-3H3/t28-/m1/s1 |
| InChIKey | DQPBTBBLMJFMME-MUUNZHRXSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [(1S)-7-methoxy-9-methyl-2-(4-methylphenyl)sulfonyl-1'-(3-pyridinylmethyl)-1-spiro[1,3-dihydropyrido[3,4-b]indole-4,4'-piperidine]yl]methanol (CHEBI:128796) is a harmala alkaloid (CHEBI:61379) |
| Manual Xrefs | Databases |
|---|---|
| LSM-40348 | LINCS |